C16H3F6N3 — CID 122595035
2-[(6E)-6-(1-cyanoethylidene)-1,3,4,5,7,8-hexafluoronaphthalen-2-ylidene]propanedinitrile (PubChem CID 122595035) has the molecular formula C16H3F6N3 and a molecular weight of 351.21 g/mol. Its IUPAC name is 2-[(6E)-6-(1-cyanoethylidene)-1,3,4,5,7,8-hexafluoronaphthalen-2-ylidene]propanedinitrile.
| Compound Name | 2-[(6E)-6-(1-cyanoethylidene)-1,3,4,5,7,8-hexafluoronaphthalen-2-ylidene]propanedinitrile |
|---|---|
| PubChem CID | 122595035 |
| Molecular Formula | C16H3F6N3 |
| Molecular Weight | 351.21 g/mol |
| Exact Mass | 351.02 |
| IUPAC Name | 2-[(6E)-6-(1-cyanoethylidene)-1,3,4,5,7,8-hexafluoronaphthalen-2-ylidene]propanedinitrile |
| SMILES | C/C(C#N)=c1\c(F)c(F)c2c(F)c(=C(C#N)C#N)c(F)c(F)c2c1F |
| InChI | InChI=1S/C16H3F6N3/c1-5(2-23)7-11(17)9-10(15(21)13(7)19)12(18)8(6(3-24)4-25)14(20)16(9)22/h1H3/b7-5+ |
| InChIKey | KFYRXHHRHAEGRH-FNORWQNLSA-N |
| XLogP | 2.57 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|