C25H31N2O2+ — CID 122595107
2,5,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione (PubChem CID 122595107) has the molecular formula C25H31N2O2+ and a molecular weight of 391.54 g/mol. Its IUPAC name is 2,5,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione.
| Compound Name | 2,5,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione |
|---|---|
| PubChem CID | 122595107 |
| Molecular Formula | C25H31N2O2+ |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | 2,5,5-trimethyl-1,3-bis(2,4,6-trimethylphenyl)pyrimidin-1-ium-4,6-dione |
| SMILES | CC1=[N+](c2c(C)cc(C)cc2C)C(=O)C(C)(C)C(=O)N1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C25H31N2O2/c1-14-10-16(3)21(17(4)11-14)26-20(7)27(24(29)25(8,9)23(26)28)22-18(5)12-15(2)13-19(22)6/h10-13H,1-9H3/q+1 |
| InChIKey | SHLNXMXXPILXGY-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 40.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|