About 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine
2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine (PubChem CID 122595292) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine |
| PubChem CID | 122595292 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine |
| SMILES | C=CCc1nc(C)nc(C)n1 |
| InChI | InChI=1S/C8H11N3/c1-4-5-8-10-6(2)9-7(3)11-8/h4H,1,5H2,2-3H3 |
| InChIKey | QDUSPAJZAHMNLQ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine?
The IUPAC name of 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine (CID 122595292) is 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine.
What is the SMILES notation for 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine?
The canonical SMILES for 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine is C=CCc1nc(C)nc(C)n1.
What is the InChIKey of 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine?
The InChIKey is QDUSPAJZAHMNLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c1-4-5-8-10-6(2)9-7(3)11-8/h4H,1,5H2,2-3H3.
What are the key properties of 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine?
2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine has a molecular weight of 149.20 g/mol, XLogP of 1.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-prop-2-enyl-1,3,5-triazine is sourced from PubChem (CID 122595292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).