About 3-(3,5-dioxopyrrolidin-2-yl)propanamide
3-(3,5-dioxopyrrolidin-2-yl)propanamide (PubChem CID 122595656) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(3,5-dioxopyrrolidin-2-yl)propanamide.
Molecular Properties
| Compound Name | 3-(3,5-dioxopyrrolidin-2-yl)propanamide |
| PubChem CID | 122595656 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-(3,5-dioxopyrrolidin-2-yl)propanamide |
| SMILES | NC(=O)CCC1NC(=O)CC1=O |
| InChI | InChI=1S/C7H10N2O3/c8-6(11)2-1-4-5(10)3-7(12)9-4/h4H,1-3H2,(H2,8,11)(H,9,12) |
| InChIKey | ILTFIQQXAQFJID-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,5-dioxopyrrolidin-2-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,5-dioxopyrrolidin-2-yl)propanamide?
The IUPAC name of 3-(3,5-dioxopyrrolidin-2-yl)propanamide (CID 122595656) is 3-(3,5-dioxopyrrolidin-2-yl)propanamide.
What is the SMILES notation for 3-(3,5-dioxopyrrolidin-2-yl)propanamide?
The canonical SMILES for 3-(3,5-dioxopyrrolidin-2-yl)propanamide is NC(=O)CCC1NC(=O)CC1=O.
What is the InChIKey of 3-(3,5-dioxopyrrolidin-2-yl)propanamide?
The InChIKey is ILTFIQQXAQFJID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c8-6(11)2-1-4-5(10)3-7(12)9-4/h4H,1-3H2,(H2,8,11)(H,9,12).
What are the key properties of 3-(3,5-dioxopyrrolidin-2-yl)propanamide?
3-(3,5-dioxopyrrolidin-2-yl)propanamide has a molecular weight of 170.17 g/mol, XLogP of -1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,5-dioxopyrrolidin-2-yl)propanamide is sourced from PubChem (CID 122595656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).