C28H36NO+ — CID 122595876
(5S,6R,8S)-8-methyl-6-(3-methylphenyl)-5-(4-methylphenyl)-3-propan-2-yl-8-prop-2-enyl-3,5,6,7-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-4-ium (PubChem CID 122595876) has the molecular formula C28H36NO+ and a molecular weight of 402.60 g/mol. Its IUPAC name is (5S,6R,8S)-8-methyl-6-(3-methylphenyl)-5-(4-methylphenyl)-3-propan-2-yl-8-prop-2-enyl-3,5,6,7-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-4-ium.
| Compound Name | (5S,6R,8S)-8-methyl-6-(3-methylphenyl)-5-(4-methylphenyl)-3-propan-2-yl-8-prop-2-enyl-3,5,6,7-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-4-ium |
|---|---|
| PubChem CID | 122595876 |
| Molecular Formula | C28H36NO+ |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.28 |
| IUPAC Name | (5S,6R,8S)-8-methyl-6-(3-methylphenyl)-5-(4-methylphenyl)-3-propan-2-yl-8-prop-2-enyl-3,5,6,7-tetrahydro-2H-[1,3]oxazolo[3,2-a]pyridin-4-ium |
| SMILES | C=CC[C@@]1(C)C[C@H](c2cccc(C)c2)[C@@H](c2ccc(C)cc2)[N+]2=C1OCC2C(C)C |
| InChI | InChI=1S/C28H36NO/c1-7-15-28(6)17-24(23-10-8-9-21(5)16-23)26(22-13-11-20(4)12-14-22)29-25(19(2)3)18-30-27(28)29/h7-14,16,19,24-26H,1,15,17-18H2,2-6H3/q+1/t24-,25?,26-,28+/m1/s1 |
| InChIKey | UAJVEQMTZXJOCU-WQFHROSPSA-N |
| XLogP | 6.58 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|