C22H20N2O3 — CID 122596394
(E)-5-cyclohexa-1,5-dien-3-yn-1-yl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3-oxopent-4-enamide (PubChem CID 122596394) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is (E)-5-cyclohexa-1,5-dien-3-yn-1-yl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3-oxopent-4-enamide.
| Compound Name | (E)-5-cyclohexa-1,5-dien-3-yn-1-yl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3-oxopent-4-enamide |
|---|---|
| PubChem CID | 122596394 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | (E)-5-cyclohexa-1,5-dien-3-yn-1-yl-N-[2-(5-methoxy-1H-indol-3-yl)ethyl]-3-oxopent-4-enamide |
| SMILES | COc1ccc2[nH]cc(CCNC(=O)CC(=O)/C=C/c3cc#ccc3)c2c1 |
| InChI | InChI=1S/C22H20N2O3/c1-27-19-9-10-21-20(14-19)17(15-24-21)11-12-23-22(26)13-18(25)8-7-16-5-3-2-4-6-16/h3,5-10,14-15,24H,11-13H2,1H3,(H,23,26)/b8-7+ |
| InChIKey | WHXZMBIJPQYYFY-BQYQJAHWSA-N |
| XLogP | 3.11 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|