About N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine
N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine (PubChem CID 122596871) has the molecular formula C15H22FN3
and a molecular weight of 263.36 g/mol. Its IUPAC name is N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine.
Molecular Properties
| Compound Name | N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine |
| PubChem CID | 122596871 |
| Molecular Formula | C15H22FN3 |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine |
| SMILES | C=Cc1nc(F)nc(C(C)C(C)C(C)C)c1/N=C/C |
| InChI | InChI=1S/C15H22FN3/c1-7-12-14(17-8-2)13(19-15(16)18-12)11(6)10(5)9(3)4/h7-11H,1H2,2-6H3/b17-8+ |
| InChIKey | QYSCZBKJMVFUNG-CAOOACKPSA-N |
| XLogP | 4.38 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine?
The IUPAC name of N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine (CID 122596871) is N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine.
What is the SMILES notation for N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine?
The canonical SMILES for N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine is C=Cc1nc(F)nc(C(C)C(C)C(C)C)c1/N=C/C.
What is the InChIKey of N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine?
The InChIKey is QYSCZBKJMVFUNG-CAOOACKPSA-N. The full InChI is InChI=1S/C15H22FN3/c1-7-12-14(17-8-2)13(19-15(16)18-12)11(6)10(5)9(3)4/h7-11H,1H2,2-6H3/b17-8+.
What are the key properties of N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine?
N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine has a molecular weight of 263.36 g/mol, XLogP of 4.38, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(3,4-dimethylpentan-2-yl)-6-ethenyl-2-fluoropyrimidin-5-yl]ethanimine is sourced from PubChem (CID 122596871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).