C20H34O6 — CID 122597410
1-[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]octan-2-one (PubChem CID 122597410) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]octan-2-one.
| Compound Name | 1-[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]octan-2-one |
|---|---|
| PubChem CID | 122597410 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-[(3aR,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-6-yl]octan-2-one |
| SMILES | CCCCCCC(=O)CC1C([C@H]2COC(C)(C)O2)O[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C20H34O6/c1-6-7-8-9-10-13(21)11-14-16(15-12-22-19(2,3)24-15)23-18-17(14)25-20(4,5)26-18/h14-18H,6-12H2,1-5H3/t14?,15-,16?,17-,18-/m1/s1 |
| InChIKey | FOCMERKUELOVQE-CAGXLSFWSA-N |
| XLogP | 3.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|