C24H18F3N3O3S — CID 122597692
[(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino] N-(2,6-dimethylphenyl)carbamate (PubChem CID 122597692) has the molecular formula C24H18F3N3O3S and a molecular weight of 485.49 g/mol. Its IUPAC name is [(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino] N-(2,6-dimethylphenyl)carbamate.
| Compound Name | [(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino] N-(2,6-dimethylphenyl)carbamate |
|---|---|
| PubChem CID | 122597692 |
| Molecular Formula | C24H18F3N3O3S |
| Molecular Weight | 485.49 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [(E)-[2-[4-(trifluoromethoxy)phenyl]-1,3-benzothiazol-5-yl]methylideneamino] N-(2,6-dimethylphenyl)carbamate |
| SMILES | Cc1cccc(C)c1NC(=O)O/N=C/c1ccc2sc(-c3ccc(OC(F)(F)F)cc3)nc2c1 |
| InChI | InChI=1S/C24H18F3N3O3S/c1-14-4-3-5-15(2)21(14)30-23(31)33-28-13-16-6-11-20-19(12-16)29-22(34-20)17-7-9-18(10-8-17)32-24(25,26)27/h3-13H,1-2H3,(H,30,31)/b28-13+ |
| InChIKey | PQVPFODBICYBQP-XODNFHPESA-N |
| XLogP | 7.06 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.49 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|