C21H22F2N8O — CID 122598155
1-[(3S)-1-cyano-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-3-[1,4-dimethyl-3-(1-methylpyrazol-4-yl)pyrazol-5-yl]urea (PubChem CID 122598155) has the molecular formula C21H22F2N8O and a molecular weight of 440.46 g/mol. Its IUPAC name is 1-[(3S)-1-cyano-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-3-[1,4-dimethyl-3-(1-methylpyrazol-4-yl)pyrazol-5-yl]urea.
| Compound Name | 1-[(3S)-1-cyano-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-3-[1,4-dimethyl-3-(1-methylpyrazol-4-yl)pyrazol-5-yl]urea |
|---|---|
| PubChem CID | 122598155 |
| Molecular Formula | C21H22F2N8O |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 1-[(3S)-1-cyano-4-(3,4-difluorophenyl)pyrrolidin-3-yl]-3-[1,4-dimethyl-3-(1-methylpyrazol-4-yl)pyrazol-5-yl]urea |
| SMILES | Cc1c(-c2cnn(C)c2)nn(C)c1NC(=O)N[C@@H]1CN(C#N)CC1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C21H22F2N8O/c1-12-19(14-7-25-29(2)8-14)28-30(3)20(12)27-21(32)26-18-10-31(11-24)9-15(18)13-4-5-16(22)17(23)6-13/h4-8,15,18H,9-10H2,1-3H3,(H2,26,27,32)/t15?,18-/m1/s1 |
| InChIKey | ATFQJPLNDSAHGN-KPMSDPLLSA-N |
| XLogP | 2.48 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|