C14H27N — CID 122598433
1,6,6-tri(propan-2-yl)-2,5-dihydropyridine (PubChem CID 122598433) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 1,6,6-tri(propan-2-yl)-2,5-dihydropyridine.
| Compound Name | 1,6,6-tri(propan-2-yl)-2,5-dihydropyridine |
|---|---|
| PubChem CID | 122598433 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 1,6,6-tri(propan-2-yl)-2,5-dihydropyridine |
| SMILES | CC(C)N1CC=CCC1(C(C)C)C(C)C |
| InChI | InChI=1S/C14H27N/c1-11(2)14(12(3)4)9-7-8-10-15(14)13(5)6/h7-8,11-13H,9-10H2,1-6H3 |
| InChIKey | DQGRWPOLQVXQJI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|