C12H17N5O — CID 122598684
(2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol (PubChem CID 122598684) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol.
| Compound Name | (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 122598684 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | (2S)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]pentan-1-ol |
| SMILES | CCC[C@@H](CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C12H17N5O/c1-2-4-8(7-18)15-11-10-9(5-3-6-14-10)16-12(13)17-11/h3,5-6,8,18H,2,4,7H2,1H3,(H3,13,15,16,17)/t8-/m0/s1 |
| InChIKey | OXDCXEIDFKATID-QMMMGPOBSA-N |
| XLogP | 1.18 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |