C14H20F2O3S — CID 122598742
(2R,3R)-1-(benzenesulfonyl)-1,1-difluoro-3-methylheptan-2-ol (PubChem CID 122598742) has the molecular formula C14H20F2O3S and a molecular weight of 306.37 g/mol. Its IUPAC name is (2R,3R)-1-(benzenesulfonyl)-1,1-difluoro-3-methylheptan-2-ol.
| Compound Name | (2R,3R)-1-(benzenesulfonyl)-1,1-difluoro-3-methylheptan-2-ol |
|---|---|
| PubChem CID | 122598742 |
| Molecular Formula | C14H20F2O3S |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | (2R,3R)-1-(benzenesulfonyl)-1,1-difluoro-3-methylheptan-2-ol |
| SMILES | CCCC[C@@H](C)[C@@H](O)C(F)(F)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C14H20F2O3S/c1-3-4-8-11(2)13(17)14(15,16)20(18,19)12-9-6-5-7-10-12/h5-7,9-11,13,17H,3-4,8H2,1-2H3/t11-,13-/m1/s1 |
| InChIKey | NGYSQSSXSWHFHP-DGCLKSJQSA-N |
| XLogP | 3.24 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |