C15H23N5O — CID 122598756
(2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptan-1-ol (PubChem CID 122598756) has the molecular formula C15H23N5O and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptan-1-ol.
| Compound Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptan-1-ol |
|---|---|
| PubChem CID | 122598756 |
| Molecular Formula | C15H23N5O |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.19 |
| IUPAC Name | (2R)-2-[(2-aminopyrido[3,2-d]pyrimidin-4-yl)amino]-2-methylheptan-1-ol |
| SMILES | CCCCC[C@](C)(CO)Nc1nc(N)nc2cccnc12 |
| InChI | InChI=1S/C15H23N5O/c1-3-4-5-8-15(2,10-21)20-13-12-11(7-6-9-17-12)18-14(16)19-13/h6-7,9,21H,3-5,8,10H2,1-2H3,(H3,16,18,19,20)/t15-/m1/s1 |
| InChIKey | KHLLPJKKQUEQMJ-OAHLLOKOSA-N |
| XLogP | 2.35 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|