C19H27BrN2 — CID 122599015
N-[[(2R,3S,4R)-3-(4-bromophenyl)-4-ethyl-1-prop-2-enylazetidin-2-yl]methyl]-N-methylprop-2-en-1-amine (PubChem CID 122599015) has the molecular formula C19H27BrN2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[[(2R,3S,4R)-3-(4-bromophenyl)-4-ethyl-1-prop-2-enylazetidin-2-yl]methyl]-N-methylprop-2-en-1-amine.
| Compound Name | N-[[(2R,3S,4R)-3-(4-bromophenyl)-4-ethyl-1-prop-2-enylazetidin-2-yl]methyl]-N-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 122599015 |
| Molecular Formula | C19H27BrN2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[[(2R,3S,4R)-3-(4-bromophenyl)-4-ethyl-1-prop-2-enylazetidin-2-yl]methyl]-N-methylprop-2-en-1-amine |
| SMILES | C=CCN(C)C[C@H]1[C@@H](c2ccc(Br)cc2)[C@@H](CC)N1CC=C |
| InChI | InChI=1S/C19H27BrN2/c1-5-12-21(4)14-18-19(15-8-10-16(20)11-9-15)17(7-3)22(18)13-6-2/h5-6,8-11,17-19H,1-2,7,12-14H2,3-4H3/t17-,18+,19+/m1/s1 |
| InChIKey | YFQPPMLBAFDAPH-QYZOEREBSA-N |
| XLogP | 4.30 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|