C13H26OS — CID 122599323
(3S,5S)-2-ethyl-3,4,5-trimethyl-6-propan-2-ylsulfanyloxane (PubChem CID 122599323) has the molecular formula C13H26OS and a molecular weight of 230.42 g/mol. Its IUPAC name is (3S,5S)-2-ethyl-3,4,5-trimethyl-6-propan-2-ylsulfanyloxane.
| Compound Name | (3S,5S)-2-ethyl-3,4,5-trimethyl-6-propan-2-ylsulfanyloxane |
|---|---|
| PubChem CID | 122599323 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | (3S,5S)-2-ethyl-3,4,5-trimethyl-6-propan-2-ylsulfanyloxane |
| SMILES | CCC1OC(SC(C)C)[C@@H](C)C(C)[C@@H]1C |
| InChI | InChI=1S/C13H26OS/c1-7-12-10(5)9(4)11(6)13(14-12)15-8(2)3/h8-13H,7H2,1-6H3/t9?,10-,11-,12?,13?/m0/s1 |
| InChIKey | GNRNEOPLBHBEQM-LNVMCSJMSA-N |
| XLogP | 4.17 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |