C9H15FO3S — CID 122599528
2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanethiol (PubChem CID 122599528) has the molecular formula C9H15FO3S and a molecular weight of 222.28 g/mol. Its IUPAC name is 2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanethiol.
| Compound Name | 2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanethiol |
|---|---|
| PubChem CID | 122599528 |
| Molecular Formula | C9H15FO3S |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2-[(3aR,5R,6S,6aS)-6-fluoro-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethanethiol |
| SMILES | CC1(C)O[C@H]2O[C@H](CCS)[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C9H15FO3S/c1-9(2)12-7-6(10)5(3-4-14)11-8(7)13-9/h5-8,14H,3-4H2,1-2H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | RMSURQIKYRCNEV-ULAWRXDQSA-N |
| XLogP | 1.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|