C12H18O — CID 122600345
(Z,6E)-6-ethylidenedec-7-en-4-yn-1-ol (PubChem CID 122600345) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (Z,6E)-6-ethylidenedec-7-en-4-yn-1-ol.
| Compound Name | (Z,6E)-6-ethylidenedec-7-en-4-yn-1-ol |
|---|---|
| PubChem CID | 122600345 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (Z,6E)-6-ethylidenedec-7-en-4-yn-1-ol |
| SMILES | C/C=C(C#CCCCO)\C=C/CC |
| InChI | InChI=1S/C12H18O/c1-3-5-9-12(4-2)10-7-6-8-11-13/h4-5,9,13H,3,6,8,11H2,1-2H3/b9-5-,12-4+ |
| InChIKey | TWWDFXZZIJGJRA-WQPWRAGBSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|