About (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one
(6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one (PubChem CID 122600545) has the molecular formula C26H24N4O2
and a molecular weight of 424.50 g/mol. Its IUPAC name is (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one.
Molecular Properties
| Compound Name | (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one |
| PubChem CID | 122600545 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one |
| SMILES | O=C(c1ccc2[nH]ncc2c1)N1CC(=O)N(Cc2ccccc2)[C@@H](Cc2ccccc2)C1 |
| InChI | InChI=1S/C26H24N4O2/c31-25-18-29(26(32)21-11-12-24-22(14-21)15-27-28-24)17-23(13-19-7-3-1-4-8-19)30(25)16-20-9-5-2-6-10-20/h1-12,14-15,23H,13,16-18H2,(H,27,28)/t23-/m0/s1 |
| InChIKey | ULLIHRHSMFNOFE-QHCPKHFHSA-N |
| XLogP | 3.66 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one?
The IUPAC name of (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one (CID 122600545) is (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one.
What is the SMILES notation for (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one?
The canonical SMILES for (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one is O=C(c1ccc2[nH]ncc2c1)N1CC(=O)N(Cc2ccccc2)[C@@H](Cc2ccccc2)C1.
What is the InChIKey of (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one?
The InChIKey is ULLIHRHSMFNOFE-QHCPKHFHSA-N. The full InChI is InChI=1S/C26H24N4O2/c31-25-18-29(26(32)21-11-12-24-22(14-21)15-27-28-24)17-23(13-19-7-3-1-4-8-19)30(25)16-20-9-5-2-6-10-20/h1-12,14-15,23H,13,16-18H2,(H,27,28)/t23-/m0/s1.
What are the key properties of (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one?
(6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one has a molecular weight of 424.50 g/mol, XLogP of 3.66, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,6-dibenzyl-4-(1H-indazole-5-carbonyl)piperazin-2-one is sourced from PubChem (CID 122600545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).