About (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one
(6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one (PubChem CID 122600547) has the molecular formula C28H30N2O3
and a molecular weight of 442.56 g/mol. Its IUPAC name is (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one.
Molecular Properties
| Compound Name | (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one |
| PubChem CID | 122600547 |
| Molecular Formula | C28H30N2O3 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one |
| SMILES | CC(C)Oc1ccc(C(=O)N2CC(=O)N(Cc3ccccc3)[C@@H](Cc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C28H30N2O3/c1-21(2)33-26-15-13-24(14-16-26)28(32)29-19-25(17-22-9-5-3-6-10-22)30(27(31)20-29)18-23-11-7-4-8-12-23/h3-16,21,25H,17-20H2,1-2H3/t25-/m0/s1 |
| InChIKey | RZCFIEQVUOGJRZ-VWLOTQADSA-N |
| XLogP | 4.57 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one?
The IUPAC name of (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one (CID 122600547) is (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one.
What is the SMILES notation for (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one?
The canonical SMILES for (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one is CC(C)Oc1ccc(C(=O)N2CC(=O)N(Cc3ccccc3)[C@@H](Cc3ccccc3)C2)cc1.
What is the InChIKey of (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one?
The InChIKey is RZCFIEQVUOGJRZ-VWLOTQADSA-N. The full InChI is InChI=1S/C28H30N2O3/c1-21(2)33-26-15-13-24(14-16-26)28(32)29-19-25(17-22-9-5-3-6-10-22)30(27(31)20-29)18-23-11-7-4-8-12-23/h3-16,21,25H,17-20H2,1-2H3/t25-/m0/s1.
What are the key properties of (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one?
(6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one has a molecular weight of 442.56 g/mol, XLogP of 4.57, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-1,6-dibenzyl-4-(4-propan-2-yloxybenzoyl)piperazin-2-one is sourced from PubChem (CID 122600547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).