About [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate
[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate (PubChem CID 122601855) has the molecular formula C11H19N5O3
and a molecular weight of 269.31 g/mol. Its IUPAC name is [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate |
| PubChem CID | 122601855 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)Oc1nc(N)nc(OCC(C)C)c1N |
| InChI | InChI=1S/C11H19N5O3/c1-4-14-11(17)19-9-7(12)8(15-10(13)16-9)18-5-6(2)3/h6H,4-5,12H2,1-3H3,(H,14,17)(H2,13,15,16) |
| InChIKey | KSZCGJKIPVQLDR-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 125.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate?
The IUPAC name of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate (CID 122601855) is [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate.
What is the SMILES notation for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate?
The canonical SMILES for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate is CCNC(=O)Oc1nc(N)nc(OCC(C)C)c1N.
What is the InChIKey of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate?
The InChIKey is KSZCGJKIPVQLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N5O3/c1-4-14-11(17)19-9-7(12)8(15-10(13)16-9)18-5-6(2)3/h6H,4-5,12H2,1-3H3,(H,14,17)(H2,13,15,16).
What are the key properties of [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate?
[2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate has a molecular weight of 269.31 g/mol, XLogP of 0.78, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-diamino-6-(2-methylpropoxy)pyrimidin-4-yl] N-ethylcarbamate is sourced from PubChem (CID 122601855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).