C30H36ClF2N4O6P — CID 122602092
ditert-butyl [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl phosphate (PubChem CID 122602092) has the molecular formula C30H36ClF2N4O6P and a molecular weight of 653.06 g/mol. Its IUPAC name is ditert-butyl [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl phosphate.
| Compound Name | ditert-butyl [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl phosphate |
|---|---|
| PubChem CID | 122602092 |
| Molecular Formula | C30H36ClF2N4O6P |
| Molecular Weight | 653.06 g/mol |
| Exact Mass | 652.20 |
| IUPAC Name | ditert-butyl [2-[6-chloro-8-fluoro-4-(4-prop-2-enoylpiperazin-1-yl)quinazolin-7-yl]-3-fluorophenoxy]methyl phosphate |
| SMILES | C=CC(=O)N1CCN(c2ncnc3c(F)c(-c4c(F)cccc4OCOP(=O)(OC(C)(C)C)OC(C)(C)C)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C30H36ClF2N4O6P/c1-8-23(38)36-12-14-37(15-13-36)28-19-16-20(31)24(26(33)27(19)34-17-35-28)25-21(32)10-9-11-22(25)40-18-41-44(39,42-29(2,3)4)43-30(5,6)7/h8-11,16-17H,1,12-15,18H2,2-7H3 |
| InChIKey | GVCRNMLRVYHRFN-UHFFFAOYSA-N |
| XLogP | 7.15 |
| TPSA | 103.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.06 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|