C29H30ClFN6O3 — CID 122602101
1-[4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)-2-(oxan-4-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122602101) has the molecular formula C29H30ClFN6O3 and a molecular weight of 565.05 g/mol. Its IUPAC name is 1-[4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)-2-(oxan-4-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)-2-(oxan-4-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122602101 |
| Molecular Formula | C29H30ClFN6O3 |
| Molecular Weight | 565.05 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 1-[4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)-2-(oxan-4-ylmethoxy)quinazolin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(c2nc(OCC3CCOCC3)nc3c(F)c(-c4c(C)ccc5[nH]ncc45)c(Cl)cc23)CC1 |
| InChI | InChI=1S/C29H30ClFN6O3/c1-3-23(38)36-8-10-37(11-9-36)28-19-14-21(30)25(24-17(2)4-5-22-20(24)15-32-35-22)26(31)27(19)33-29(34-28)40-16-18-6-12-39-13-7-18/h3-5,14-15,18H,1,6-13,16H2,2H3,(H,32,35) |
| InChIKey | LSONJSZEIYRAPU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 96.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.05 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|