C25H24ClFN6O — CID 122602193
1-[(3R,5S)-4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]-3,5-dimethylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 122602193) has the molecular formula C25H24ClFN6O and a molecular weight of 478.96 g/mol. Its IUPAC name is 1-[(3R,5S)-4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]-3,5-dimethylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,5S)-4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]-3,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122602193 |
| Molecular Formula | C25H24ClFN6O |
| Molecular Weight | 478.96 g/mol |
| Exact Mass | 478.17 |
| IUPAC Name | 1-[(3R,5S)-4-[6-chloro-8-fluoro-7-(5-methyl-1H-indazol-4-yl)quinazolin-4-yl]-3,5-dimethylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](C)N(c2ncnc3c(F)c(-c4c(C)ccc5[nH]ncc45)c(Cl)cc23)[C@@H](C)C1 |
| InChI | InChI=1S/C25H24ClFN6O/c1-5-20(34)32-10-14(3)33(15(4)11-32)25-16-8-18(26)22(23(27)24(16)28-12-29-25)21-13(2)6-7-19-17(21)9-30-31-19/h5-9,12,14-15H,1,10-11H2,2-4H3,(H,30,31)/t14-,15+ |
| InChIKey | FTLZRQRJBLLHIZ-GASCZTMLSA-N |
| XLogP | 4.89 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|