C11H7F13O4 — CID 122602612
4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxymethyl)-1,3-dioxolan-2-one (PubChem CID 122602612) has the molecular formula C11H7F13O4 and a molecular weight of 450.15 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 122602612 |
| Molecular Formula | C11H7F13O4 |
| Molecular Weight | 450.15 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H7F13O4/c12-6(13,3-26-1-4-2-27-5(25)28-4)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h4H,1-3H2 |
| InChIKey | FWFCPXOTXADMFA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.15 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|