C11H5F15O4 — CID 122602613
4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-1,3-dioxolan-2-one (PubChem CID 122602613) has the molecular formula C11H5F15O4 and a molecular weight of 486.13 g/mol. Its IUPAC name is 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 122602613 |
| Molecular Formula | C11H5F15O4 |
| Molecular Weight | 486.13 g/mol |
| Exact Mass | 485.99 |
| IUPAC Name | 4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptoxymethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(COC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)O1 |
| InChI | InChI=1S/C11H5F15O4/c12-5(13,6(14,15)8(18,19)10(22,23)24)7(16,17)9(20,21)11(25,26)29-2-3-1-28-4(27)30-3/h3H,1-2H2 |
| InChIKey | AMFPLCHYZMCKCF-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.13 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|