C30H22BrF4N3O2 — CID 122602685
tert-butyl 2-[6-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-1H-benzimidazol-2-yl]pyrrole-1-carboxylate (PubChem CID 122602685) has the molecular formula C30H22BrF4N3O2 and a molecular weight of 612.42 g/mol. Its IUPAC name is tert-butyl 2-[6-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-1H-benzimidazol-2-yl]pyrrole-1-carboxylate.
| Compound Name | tert-butyl 2-[6-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-1H-benzimidazol-2-yl]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 122602685 |
| Molecular Formula | C30H22BrF4N3O2 |
| Molecular Weight | 612.42 g/mol |
| Exact Mass | 611.08 |
| IUPAC Name | tert-butyl 2-[6-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-1H-benzimidazol-2-yl]pyrrole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)n1cccc1-c1nc2ccc(-c3ccc4c(c3)C(F)(F)C(F)(F)c3cc(Br)ccc3-4)cc2[nH]1 |
| InChI | InChI=1S/C30H22BrF4N3O2/c1-28(2,3)40-27(39)38-12-4-5-25(38)26-36-23-11-7-17(14-24(23)37-26)16-6-9-19-20-10-8-18(31)15-22(20)30(34,35)29(32,33)21(19)13-16/h4-15H,1-3H3,(H,36,37) |
| InChIKey | JPBXKEYAYJXUEP-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.42 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|