C26H24BrF4NO5 — CID 122602692
2-O-[2-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate (PubChem CID 122602692) has the molecular formula C26H24BrF4NO5 and a molecular weight of 586.38 g/mol. Its IUPAC name is 2-O-[2-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate.
| Compound Name | 2-O-[2-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 122602692 |
| Molecular Formula | C26H24BrF4NO5 |
| Molecular Weight | 586.38 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | 2-O-[2-(7-bromo-9,9,10,10-tetrafluorophenanthren-2-yl)-2-oxoethyl] 1-O-tert-butyl (2S)-pyrrolidine-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)OCC(=O)c1ccc2c(c1)C(F)(F)C(F)(F)c1cc(Br)ccc1-2 |
| InChI | InChI=1S/C26H24BrF4NO5/c1-24(2,3)37-23(35)32-10-4-5-20(32)22(34)36-13-21(33)14-6-8-16-17-9-7-15(27)12-19(17)26(30,31)25(28,29)18(16)11-14/h6-9,11-12,20H,4-5,10,13H2,1-3H3/t20-/m0/s1 |
| InChIKey | UXHIFWLABSLXBW-FQEVSTJZSA-N |
| XLogP | 6.44 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.38 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|