About ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate
ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate (PubChem CID 122603240) has the molecular formula C22H22F6O4S
and a molecular weight of 496.47 g/mol. Its IUPAC name is ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate |
| PubChem CID | 122603240 |
| Molecular Formula | C22H22F6O4S |
| Molecular Weight | 496.47 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate |
| SMILES | CCCCOc1ccc(-c2ccc(OC(F)(F)F)c(F)c2SCCC(=O)OCC)c(F)c1F |
| InChI | InChI=1S/C22H22F6O4S/c1-3-5-11-31-15-8-6-13(18(23)19(15)24)14-7-9-16(32-22(26,27)28)20(25)21(14)33-12-10-17(29)30-4-2/h6-9H,3-5,10-12H2,1-2H3 |
| InChIKey | DKPAGBLGOZPJFT-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The IUPAC name of ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate (CID 122603240) is ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate.
What is the SMILES notation for ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The canonical SMILES for ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate is CCCCOc1ccc(-c2ccc(OC(F)(F)F)c(F)c2SCCC(=O)OCC)c(F)c1F.
What is the InChIKey of ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The InChIKey is DKPAGBLGOZPJFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F6O4S/c1-3-5-11-31-15-8-6-13(18(23)19(15)24)14-7-9-16(32-22(26,27)28)20(25)21(14)33-12-10-17(29)30-4-2/h6-9H,3-5,10-12H2,1-2H3.
What are the key properties of ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate has a molecular weight of 496.47 g/mol, XLogP of 6.89, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[6-(4-butoxy-2,3-difluorophenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate is sourced from PubChem (CID 122603240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).