About 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid
4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid (PubChem CID 122603255) has the molecular formula C12H19NO9
and a molecular weight of 321.28 g/mol. Its IUPAC name is 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid |
| PubChem CID | 122603255 |
| Molecular Formula | C12H19NO9 |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.11 |
| IUPAC Name | 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid |
| SMILES | CCOC(CC(=O)O)(OCC)C(=O)OC(=O)C(N)CC(=O)O |
| InChI | InChI=1S/C12H19NO9/c1-3-20-12(21-4-2,6-9(16)17)11(19)22-10(18)7(13)5-8(14)15/h7H,3-6,13H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | BFVMHSMJDQTKBF-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 162.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid?
The IUPAC name of 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid (CID 122603255) is 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid.
What is the SMILES notation for 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid?
The canonical SMILES for 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid is CCOC(CC(=O)O)(OCC)C(=O)OC(=O)C(N)CC(=O)O.
What is the InChIKey of 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid?
The InChIKey is BFVMHSMJDQTKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO9/c1-3-20-12(21-4-2,6-9(16)17)11(19)22-10(18)7(13)5-8(14)15/h7H,3-6,13H2,1-2H3,(H,14,15)(H,16,17).
What are the key properties of 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid?
4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid has a molecular weight of 321.28 g/mol, XLogP of -0.90, 10 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-amino-3-carboxypropanoyl)oxy-3,3-diethoxy-4-oxobutanoic acid is sourced from PubChem (CID 122603255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).