C17H20N4O4 — CID 122603685
methyl 2-[6-(4-acetylpiperazin-1-yl)-4-oxoquinazolin-3-yl]acetate (PubChem CID 122603685) has the molecular formula C17H20N4O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 2-[6-(4-acetylpiperazin-1-yl)-4-oxoquinazolin-3-yl]acetate.
| Compound Name | methyl 2-[6-(4-acetylpiperazin-1-yl)-4-oxoquinazolin-3-yl]acetate |
|---|---|
| PubChem CID | 122603685 |
| Molecular Formula | C17H20N4O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.15 |
| IUPAC Name | methyl 2-[6-(4-acetylpiperazin-1-yl)-4-oxoquinazolin-3-yl]acetate |
| SMILES | COC(=O)Cn1cnc2ccc(N3CCN(C(C)=O)CC3)cc2c1=O |
| InChI | InChI=1S/C17H20N4O4/c1-12(22)19-5-7-20(8-6-19)13-3-4-15-14(9-13)17(24)21(11-18-15)10-16(23)25-2/h3-4,9,11H,5-8,10H2,1-2H3 |
| InChIKey | LLMVRWJWYYRCBD-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |