C22H22BrNO3 — CID 122604024
1-[(3aS,4R,9bR)-4-(2-bromo-4,5-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone (PubChem CID 122604024) has the molecular formula C22H22BrNO3 and a molecular weight of 428.33 g/mol. Its IUPAC name is 1-[(3aS,4R,9bR)-4-(2-bromo-4,5-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone.
| Compound Name | 1-[(3aS,4R,9bR)-4-(2-bromo-4,5-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone |
|---|---|
| PubChem CID | 122604024 |
| Molecular Formula | C22H22BrNO3 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.08 |
| IUPAC Name | 1-[(3aS,4R,9bR)-4-(2-bromo-4,5-dimethoxyphenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-8-yl]ethanone |
| SMILES | COc1cc(Br)c([C@@H]2Nc3ccc(C(C)=O)cc3[C@@H]3C=CC[C@@H]32)cc1OC |
| InChI | InChI=1S/C22H22BrNO3/c1-12(25)13-7-8-19-16(9-13)14-5-4-6-15(14)22(24-19)17-10-20(26-2)21(27-3)11-18(17)23/h4-5,7-11,14-15,22,24H,6H2,1-3H3/t14-,15+,22-/m1/s1 |
| InChIKey | JTBAWKCKELUXPB-ZCCHDVMBSA-N |
| XLogP | 5.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|