C20H22F2N4O5 — CID 122604539
N-[(3R,4S)-4-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide (PubChem CID 122604539) has the molecular formula C20H22F2N4O5 and a molecular weight of 436.42 g/mol. Its IUPAC name is N-[(3R,4S)-4-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide.
| Compound Name | N-[(3R,4S)-4-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 122604539 |
| Molecular Formula | C20H22F2N4O5 |
| Molecular Weight | 436.42 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | N-[(3R,4S)-4-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]oxolan-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@H]1COC[C@H]1Nc1ncc(OCc2c(F)c(OC)cc(OC)c2F)cn1 |
| InChI | InChI=1S/C20H22F2N4O5/c1-4-17(27)25-13-9-30-10-14(13)26-20-23-6-11(7-24-20)31-8-12-18(21)15(28-2)5-16(29-3)19(12)22/h4-7,13-14H,1,8-10H2,2-3H3,(H,25,27)(H,23,24,26)/t13-,14+/m0/s1 |
| InChIKey | FPLYXYDSEPGNHS-UONOGXRCSA-N |
| XLogP | 1.83 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.42 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|