About bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane
bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane (PubChem CID 122604547) has the molecular formula C27H24BrF2O2P
and a molecular weight of 529.36 g/mol. Its IUPAC name is bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane.
Molecular Properties
| Compound Name | bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane |
| PubChem CID | 122604547 |
| Molecular Formula | C27H24BrF2O2P |
| Molecular Weight | 529.36 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane |
| SMILES | COc1cc(OC)c(F)c(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c1F |
| InChI | InChI=1S/C27H24BrF2O2P/c1-31-24-18-25(32-2)27(30)23(26(24)29)19-33(28,20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-18H,19H2,1-2H3 |
| InChIKey | CKBFYXWFHPFESN-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 529.36 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane?
The IUPAC name of bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane (CID 122604547) is bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane.
What is the SMILES notation for bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane?
The canonical SMILES for bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane is COc1cc(OC)c(F)c(CP(Br)(c2ccccc2)(c2ccccc2)c2ccccc2)c1F.
What is the InChIKey of bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane?
The InChIKey is CKBFYXWFHPFESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24BrF2O2P/c1-31-24-18-25(32-2)27(30)23(26(24)29)19-33(28,20-12-6-3-7-13-20,21-14-8-4-9-15-21)22-16-10-5-11-17-22/h3-18H,19H2,1-2H3.
What are the key properties of bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane?
bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane has a molecular weight of 529.36 g/mol, XLogP of 6.32, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo-[(2,6-difluoro-3,5-dimethoxyphenyl)methyl]-triphenyl-λ5-phosphane is sourced from PubChem (CID 122604547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).