C20H26N2O8 — CID 122604681
(E)-2,3-bis[(1Z)-1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide (PubChem CID 122604681) has the molecular formula C20H26N2O8 and a molecular weight of 422.43 g/mol. Its IUPAC name is (E)-2,3-bis[(1Z)-1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide.
| Compound Name | (E)-2,3-bis[(1Z)-1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide |
|---|---|
| PubChem CID | 122604681 |
| Molecular Formula | C20H26N2O8 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (E)-2,3-bis[(1Z)-1-(5,5-dimethyl-2-oxo-1,3-dioxolan-4-ylidene)propyl]but-2-enediamide |
| SMILES | CCC(=C1/OC(=O)OC1(C)C)/C(C(N)=O)=C(C(N)=O)/C(CC)=C1\OC(=O)OC1(C)C |
| InChI | InChI=1S/C20H26N2O8/c1-7-9(13-19(3,4)29-17(25)27-13)11(15(21)23)12(16(22)24)10(8-2)14-20(5,6)30-18(26)28-14/h7-8H2,1-6H3,(H2,21,23)(H2,22,24)/b12-11+,13-9-,14-10- |
| InChIKey | VRPWVJTXYGHIAZ-GVLBTXJGSA-N |
| XLogP | 2.47 |
| TPSA | 157.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|