C15H27N3O6 — CID 122604946
3-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]piperidine-1-carboxylic acid (PubChem CID 122604946) has the molecular formula C15H27N3O6 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]piperidine-1-carboxylic acid.
| Compound Name | 3-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122604946 |
| Molecular Formula | C15H27N3O6 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 3-methoxycarbonyl-3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]piperidine-1-carboxylic acid |
| SMILES | COC(=O)C1(NCCNC(=O)OC(C)(C)C)CCCN(C(=O)O)C1 |
| InChI | InChI=1S/C15H27N3O6/c1-14(2,3)24-12(20)16-7-8-17-15(11(19)23-4)6-5-9-18(10-15)13(21)22/h17H,5-10H2,1-4H3,(H,16,20)(H,21,22) |
| InChIKey | WFVNGHWIGAYGSM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 117.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|