C26H31F2N5O3 — CID 122605507
5-[(2,6-difluoro-3-methoxy-5-methylphenyl)methoxy]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]pyrimidin-2-amine (PubChem CID 122605507) has the molecular formula C26H31F2N5O3 and a molecular weight of 499.56 g/mol. Its IUPAC name is 5-[(2,6-difluoro-3-methoxy-5-methylphenyl)methoxy]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]pyrimidin-2-amine.
| Compound Name | 5-[(2,6-difluoro-3-methoxy-5-methylphenyl)methoxy]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 122605507 |
| Molecular Formula | C26H31F2N5O3 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.24 |
| IUPAC Name | 5-[(2,6-difluoro-3-methoxy-5-methylphenyl)methoxy]-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]phenyl]pyrimidin-2-amine |
| SMILES | COCCN1CCN(c2ccc(Nc3ncc(OCc4c(F)c(C)cc(OC)c4F)cn3)cc2)CC1 |
| InChI | InChI=1S/C26H31F2N5O3/c1-18-14-23(35-3)25(28)22(24(18)27)17-36-21-15-29-26(30-16-21)31-19-4-6-20(7-5-19)33-10-8-32(9-11-33)12-13-34-2/h4-7,14-16H,8-13,17H2,1-3H3,(H,29,30,31) |
| InChIKey | WOGHVHKKOFAZGI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|