About 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene
12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene (PubChem CID 122605718) has the molecular formula C11H16N2
and a molecular weight of 176.26 g/mol. Its IUPAC name is 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene.
Analyze 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene?
The IUPAC name of 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene (CID 122605718) is 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene.
What is the SMILES notation for 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene?
The canonical SMILES for 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene is CC1=CCC=C=C2CCNCCN21.
What is the InChIKey of 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene?
The InChIKey is KIJSRFOCIFFKIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2/c1-10-4-2-3-5-11-6-7-12-8-9-13(10)11/h3-4,12H,2,6-9H2,1H3.
What are the key properties of 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene?
12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene has a molecular weight of 176.26 g/mol, XLogP of 1.63, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12-methyl-1,4-diazabicyclo[5.5.0]dodeca-7,8,11-triene is sourced from PubChem (CID 122605718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).