C14H25ClN2O — CID 122605810
N-(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)-N,2-dimethylprop-2-enamide (PubChem CID 122605810) has the molecular formula C14H25ClN2O and a molecular weight of 272.82 g/mol. Its IUPAC name is N-(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)-N,2-dimethylprop-2-enamide.
| Compound Name | N-(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)-N,2-dimethylprop-2-enamide |
|---|---|
| PubChem CID | 122605810 |
| Molecular Formula | C14H25ClN2O |
| Molecular Weight | 272.82 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | N-(1-chloro-2,2,6,6-tetramethylpiperidin-4-yl)-N,2-dimethylprop-2-enamide |
| SMILES | C=C(C)C(=O)N(C)C1CC(C)(C)N(Cl)C(C)(C)C1 |
| InChI | InChI=1S/C14H25ClN2O/c1-10(2)12(18)16(7)11-8-13(3,4)17(15)14(5,6)9-11/h11H,1,8-9H2,2-7H3 |
| InChIKey | KOYQNOHBDVTOGQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.82 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|