C17H24N+ — CID 122605928
6-ethyl-7-propan-2-ylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene (PubChem CID 122605928) has the molecular formula C17H24N+ and a molecular weight of 242.39 g/mol. Its IUPAC name is 6-ethyl-7-propan-2-ylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene.
| Compound Name | 6-ethyl-7-propan-2-ylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
|---|---|
| PubChem CID | 122605928 |
| Molecular Formula | C17H24N+ |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | 6-ethyl-7-propan-2-ylidene-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
| SMILES | CCc1c2c3c(cc1=C(C)C)CCC[N+]=3CCC2 |
| InChI | InChI=1S/C17H24N/c1-4-14-15-8-6-10-18-9-5-7-13(17(15)18)11-16(14)12(2)3/h11H,4-10H2,1-3H3/q+1 |
| InChIKey | QLKXAQVLPAGPQS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|