About tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate
tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate (PubChem CID 122605965) has the molecular formula C19H26FNO6S
and a molecular weight of 415.48 g/mol. Its IUPAC name is tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate.
Molecular Properties
| Compound Name | tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate |
| PubChem CID | 122605965 |
| Molecular Formula | C19H26FNO6S |
| Molecular Weight | 415.48 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCC2(CC1)COc1cc(OS(=O)(=O)F)ccc12 |
| InChI | InChI=1S/C19H26FNO6S/c1-18(2,3)26-17(22)6-9-21-10-7-19(8-11-21)13-25-16-12-14(4-5-15(16)19)27-28(20,23)24/h4-5,12H,6-11,13H2,1-3H3 |
| InChIKey | ATTJHTLYTYDSJM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.48 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The IUPAC name of tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate (CID 122605965) is tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate.
What is the SMILES notation for tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The canonical SMILES for tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate is CC(C)(C)OC(=O)CCN1CCC2(CC1)COc1cc(OS(=O)(=O)F)ccc12.
What is the InChIKey of tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
The InChIKey is ATTJHTLYTYDSJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26FNO6S/c1-18(2,3)26-17(22)6-9-21-10-7-19(8-11-21)13-25-16-12-14(4-5-15(16)19)27-28(20,23)24/h4-5,12H,6-11,13H2,1-3H3.
What are the key properties of tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate?
tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate has a molecular weight of 415.48 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(6-fluorosulfonyloxyspiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl)propanoate is sourced from PubChem (CID 122605965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).