About ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate
ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate (PubChem CID 122606028) has the molecular formula C19H16F6O3S
and a molecular weight of 438.39 g/mol. Its IUPAC name is ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate.
Molecular Properties
| Compound Name | ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate |
| PubChem CID | 122606028 |
| Molecular Formula | C19H16F6O3S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate |
| SMILES | CCOC(=O)CCSc1c(-c2ccc(C)c(F)c2F)ccc(OC(F)(F)F)c1F |
| InChI | InChI=1S/C19H16F6O3S/c1-3-27-14(26)8-9-29-18-12(11-5-4-10(2)15(20)16(11)21)6-7-13(17(18)22)28-19(23,24)25/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | MUQALLFMWCZDAX-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The IUPAC name of ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate (CID 122606028) is ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate.
What is the SMILES notation for ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The canonical SMILES for ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate is CCOC(=O)CCSc1c(-c2ccc(C)c(F)c2F)ccc(OC(F)(F)F)c1F.
What is the InChIKey of ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
The InChIKey is MUQALLFMWCZDAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16F6O3S/c1-3-27-14(26)8-9-29-18-12(11-5-4-10(2)15(20)16(11)21)6-7-13(17(18)22)28-19(23,24)25/h4-7H,3,8-9H2,1-2H3.
What are the key properties of ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate?
ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate has a molecular weight of 438.39 g/mol, XLogP of 6.02, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[6-(2,3-difluoro-4-methylphenyl)-2-fluoro-3-(trifluoromethoxy)phenyl]sulfanylpropanoate is sourced from PubChem (CID 122606028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).