C16H30ClNO2 — CID 122606109
(1-chloro-2,2,4,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate (PubChem CID 122606109) has the molecular formula C16H30ClNO2 and a molecular weight of 303.87 g/mol. Its IUPAC name is (1-chloro-2,2,4,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate.
| Compound Name | (1-chloro-2,2,4,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 122606109 |
| Molecular Formula | C16H30ClNO2 |
| Molecular Weight | 303.87 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | (1-chloro-2,2,4,6,6-pentamethylpiperidin-4-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)CC(C)(C)N(Cl)C(C)(C)C1 |
| InChI | InChI=1S/C16H30ClNO2/c1-9-13(2,3)12(19)20-16(8)10-14(4,5)18(17)15(6,7)11-16/h9-11H2,1-8H3 |
| InChIKey | HUVDFTYPHVWWSX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.87 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|