C24H32N6O8 — CID 122606130
1,3-bis(prop-2-enyl)-5-[2-[2-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]ethoxy]ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 122606130) has the molecular formula C24H32N6O8 and a molecular weight of 532.55 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-[2-[2-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]ethoxy]ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-[2-[2-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]ethoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 122606130 |
| Molecular Formula | C24H32N6O8 |
| Molecular Weight | 532.55 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-[2-[2-[2-[2,4,6-trioxo-3,5-bis(prop-2-enyl)-1,3,5-triazinan-1-yl]ethoxy]ethoxy]ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(CCOCCOCCn2c(=O)n(CC=C)c(=O)n(CC=C)c2=O)c1=O |
| InChI | InChI=1S/C24H32N6O8/c1-5-9-25-19(31)26(10-6-2)22(34)29(21(25)33)13-15-37-17-18-38-16-14-30-23(35)27(11-7-3)20(32)28(12-8-4)24(30)36/h5-8H,1-4,9-18H2 |
| InChIKey | XCAOWWKUYIXZTI-UHFFFAOYSA-N |
| XLogP | -1.87 |
| TPSA | 150.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.55 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|