C16H26O4 — CID 122606320
2-[(2R,3S,4R)-4-hydroxy-5-methylidene-2-octyloxolan-3-yl]prop-2-enoic acid (PubChem CID 122606320) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 2-[(2R,3S,4R)-4-hydroxy-5-methylidene-2-octyloxolan-3-yl]prop-2-enoic acid.
| Compound Name | 2-[(2R,3S,4R)-4-hydroxy-5-methylidene-2-octyloxolan-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 122606320 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2-[(2R,3S,4R)-4-hydroxy-5-methylidene-2-octyloxolan-3-yl]prop-2-enoic acid |
| SMILES | C=C(C(=O)O)[C@@H]1[C@@H](CCCCCCCC)OC(=C)[C@@H]1O |
| InChI | InChI=1S/C16H26O4/c1-4-5-6-7-8-9-10-13-14(11(2)16(18)19)15(17)12(3)20-13/h13-15,17H,2-10H2,1H3,(H,18,19)/t13-,14-,15+/m1/s1 |
| InChIKey | PXVFHURYWDGVPP-KFWWJZLASA-N |
| XLogP | 3.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|