C17H36N2O4 — CID 122606410
tert-butyl N-[2-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethyl]carbamate (PubChem CID 122606410) has the molecular formula C17H36N2O4 and a molecular weight of 332.49 g/mol. Its IUPAC name is tert-butyl N-[2-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethyl]carbamate.
| Compound Name | tert-butyl N-[2-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethyl]carbamate |
|---|---|
| PubChem CID | 122606410 |
| Molecular Formula | C17H36N2O4 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | tert-butyl N-[2-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]oxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOC(C)(C)CCOC(C)(C)CCN |
| InChI | InChI=1S/C17H36N2O4/c1-15(2,3)23-14(20)19-11-13-22-17(6,7)9-12-21-16(4,5)8-10-18/h8-13,18H2,1-7H3,(H,19,20) |
| InChIKey | RCXOJSSUOLVESA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|