C22H20F2N4O4 — CID 122606542
N-[2-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 122606542) has the molecular formula C22H20F2N4O4 and a molecular weight of 442.42 g/mol. Its IUPAC name is N-[2-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122606542 |
| Molecular Formula | C22H20F2N4O4 |
| Molecular Weight | 442.42 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | N-[2-[[5-[(2,6-difluoro-3,5-dimethoxyphenyl)methoxy]pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccccc1Nc1ncc(OCc2c(F)c(OC)cc(OC)c2F)cn1 |
| InChI | InChI=1S/C22H20F2N4O4/c1-4-19(29)27-15-7-5-6-8-16(15)28-22-25-10-13(11-26-22)32-12-14-20(23)17(30-2)9-18(31-3)21(14)24/h4-11H,1,12H2,2-3H3,(H,27,29)(H,25,26,28) |
| InChIKey | XAHULVPUYSIBDC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|