C26H17ClN4 — CID 122606697
2-[3-(3-chlorophenyl)phenyl]-4,6-dipyridin-4-ylpyrimidine (PubChem CID 122606697) has the molecular formula C26H17ClN4 and a molecular weight of 420.90 g/mol. Its IUPAC name is 2-[3-(3-chlorophenyl)phenyl]-4,6-dipyridin-4-ylpyrimidine.
| Compound Name | 2-[3-(3-chlorophenyl)phenyl]-4,6-dipyridin-4-ylpyrimidine |
|---|---|
| PubChem CID | 122606697 |
| Molecular Formula | C26H17ClN4 |
| Molecular Weight | 420.90 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 2-[3-(3-chlorophenyl)phenyl]-4,6-dipyridin-4-ylpyrimidine |
| SMILES | Clc1cccc(-c2cccc(-c3nc(-c4ccncc4)cc(-c4ccncc4)n3)c2)c1 |
| InChI | InChI=1S/C26H17ClN4/c27-23-6-2-4-21(16-23)20-3-1-5-22(15-20)26-30-24(18-7-11-28-12-8-18)17-25(31-26)19-9-13-29-14-10-19/h1-17H |
| InChIKey | FEMGNXSTFPJMNA-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.90 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |