methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate

C8H13NO4 — CID 122607276

IUPACmethyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate
SMILESCOC(=O)[C@H]1CC2(CN1)OCCO2
InChIInChI=1S/C8H13NO4/c1-11-7(10)6-4-8(5-9-6)12-2-3-13-8/h6,9H,2-5H2,1H3/t6-/m1/s1
InChIKeyMPGRFFRFKUIBDJ-ZCFIWIBFSA-N
MW187.19 g/mol
LogP-0.74
Rot. Bonds1

About methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate

methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate (PubChem CID 122607276) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate.

Molecular Properties

Compound Namemethyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate
PubChem CID122607276
Molecular FormulaC8H13NO4
Molecular Weight187.19 g/mol
Exact Mass187.08
IUPAC Namemethyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate
SMILESCOC(=O)[C@H]1CC2(CN1)OCCO2
InChIInChI=1S/C8H13NO4/c1-11-7(10)6-4-8(5-9-6)12-2-3-13-8/h6,9H,2-5H2,1H3/t6-/m1/s1
InChIKeyMPGRFFRFKUIBDJ-ZCFIWIBFSA-N
XLogP-0.74
TPSA56.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.19
LogP ≤ 5-0.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate?
The IUPAC name of methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate (CID 122607276) is methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate.
What is the SMILES notation for methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate?
The canonical SMILES for methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate is COC(=O)[C@H]1CC2(CN1)OCCO2.
What is the InChIKey of methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate?
The InChIKey is MPGRFFRFKUIBDJ-ZCFIWIBFSA-N. The full InChI is InChI=1S/C8H13NO4/c1-11-7(10)6-4-8(5-9-6)12-2-3-13-8/h6,9H,2-5H2,1H3/t6-/m1/s1.
What are the key properties of methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate?
methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate has a molecular weight of 187.19 g/mol, XLogP of -0.74, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (8R)-1,4-dioxa-7-azaspiro[4.4]nonane-8-carboxylate is sourced from PubChem (CID 122607276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).