C9H8F8O3 — CID 122607494
4-(2,2,3,3,4,4,5,5-octafluorohexyl)-1,3-dioxolan-2-one (PubChem CID 122607494) has the molecular formula C9H8F8O3 and a molecular weight of 316.14 g/mol. Its IUPAC name is 4-(2,2,3,3,4,4,5,5-octafluorohexyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(2,2,3,3,4,4,5,5-octafluorohexyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 122607494 |
| Molecular Formula | C9H8F8O3 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | 4-(2,2,3,3,4,4,5,5-octafluorohexyl)-1,3-dioxolan-2-one |
| SMILES | CC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC1COC(=O)O1 |
| InChI | InChI=1S/C9H8F8O3/c1-6(10,11)8(14,15)9(16,17)7(12,13)2-4-3-19-5(18)20-4/h4H,2-3H2,1H3 |
| InChIKey | WZDJIUHCYCQUFQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|